C15H13N3O2S2 — CID 892402
N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]benzenesulfonamide (PubChem CID 892402) has the molecular formula C15H13N3O2S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 892402 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
| SMILES | Nc1nc(-c2cccc(NS(=O)(=O)c3ccccc3)c2)cs1 |
| InChI | InChI=1S/C15H13N3O2S2/c16-15-17-14(10-21-15)11-5-4-6-12(9-11)18-22(19,20)13-7-2-1-3-8-13/h1-10,18H,(H2,16,17) |
| InChIKey | KKCQDIIMLNHEPG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |