C23H34BrN5OSi — CID 89240880
6-bromo-2-[1-[[4-[3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-1-yl]-3-pyridinyl]amino]ethenyl]pyridin-3-amine (PubChem CID 89240880) has the molecular formula C23H34BrN5OSi and a molecular weight of 504.55 g/mol. Its IUPAC name is 6-bromo-2-[1-[[4-[3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-1-yl]-3-pyridinyl]amino]ethenyl]pyridin-3-amine.
| Compound Name | 6-bromo-2-[1-[[4-[3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-1-yl]-3-pyridinyl]amino]ethenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 89240880 |
| Molecular Formula | C23H34BrN5OSi |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 6-bromo-2-[1-[[4-[3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]piperidin-1-yl]-3-pyridinyl]amino]ethenyl]pyridin-3-amine |
| SMILES | C=C(Nc1cnccc1N1CCCC(CC(C)(C)[Si](C)(C)O)C1)c1nc(Br)ccc1N |
| InChI | InChI=1S/C23H34BrN5OSi/c1-16(22-18(25)8-9-21(24)28-22)27-19-14-26-11-10-20(19)29-12-6-7-17(15-29)13-23(2,3)31(4,5)30/h8-11,14,17,27,30H,1,6-7,12-13,15,25H2,2-5H3 |
| InChIKey | VDSWTFRVSMOMSE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|