C28H40F2O2 — CID 89242617
1-[2-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-7,8-difluoro-3,4-dihydro-2H-chromen-6-yl]propan-1-ol (PubChem CID 89242617) has the molecular formula C28H40F2O2 and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[2-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-7,8-difluoro-3,4-dihydro-2H-chromen-6-yl]propan-1-ol.
| Compound Name | 1-[2-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-7,8-difluoro-3,4-dihydro-2H-chromen-6-yl]propan-1-ol |
|---|---|
| PubChem CID | 89242617 |
| Molecular Formula | C28H40F2O2 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 1-[2-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-7,8-difluoro-3,4-dihydro-2H-chromen-6-yl]propan-1-ol |
| SMILES | C=CCCC1CCC(C2CCC(C3CCc4cc(C(O)CC)c(F)c(F)c4O3)CC2)CC1 |
| InChI | InChI=1S/C28H40F2O2/c1-3-5-6-18-7-9-19(10-8-18)20-11-13-21(14-12-20)25-16-15-22-17-23(24(31)4-2)26(29)27(30)28(22)32-25/h3,17-21,24-25,31H,1,4-16H2,2H3 |
| InChIKey | DPLYNECGRNEROJ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|