About 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene
6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene (PubChem CID 58660755) has the molecular formula C22H31F3O
and a molecular weight of 368.48 g/mol. Its IUPAC name is 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene |
| PubChem CID | 58660755 |
| Molecular Formula | C22H31F3O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene |
| SMILES | CCCCc1cc(F)c2c(c1)CCC(C1CCC(CCC(F)F)CC1)O2 |
| InChI | InChI=1S/C22H31F3O/c1-2-3-4-16-13-18-10-11-20(26-22(18)19(23)14-16)17-8-5-15(6-9-17)7-12-21(24)25/h13-15,17,20-21H,2-12H2,1H3 |
| InChIKey | RFKKSHSGUSFQCW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene?
The IUPAC name of 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene (CID 58660755) is 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene.
What is the SMILES notation for 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene?
The canonical SMILES for 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene is CCCCc1cc(F)c2c(c1)CCC(C1CCC(CCC(F)F)CC1)O2.
What is the InChIKey of 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene?
The InChIKey is RFKKSHSGUSFQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31F3O/c1-2-3-4-16-13-18-10-11-20(26-22(18)19(23)14-16)17-8-5-15(6-9-17)7-12-21(24)25/h13-15,17,20-21H,2-12H2,1H3.
What are the key properties of 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene?
6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene has a molecular weight of 368.48 g/mol, XLogP of 6.71, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-2-[4-(3,3-difluoropropyl)cyclohexyl]-8-fluoro-3,4-dihydro-2H-chromene is sourced from PubChem (CID 58660755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).