About 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine
5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 89243573) has the molecular formula C6H10FN
and a molecular weight of 115.15 g/mol. Its IUPAC name is 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine.
Analyze 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine?
The IUPAC name of 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine (CID 89243573) is 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine.
What is the SMILES notation for 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine?
The canonical SMILES for 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine is CC1=C(F)CNCC1.
What is the InChIKey of 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine?
The InChIKey is LEQIZPZTVBPHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FN/c1-5-2-3-8-4-6(5)7/h8H,2-4H2,1H3.
What are the key properties of 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine?
5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine has a molecular weight of 115.15 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-methyl-1,2,3,6-tetrahydropyridine is sourced from PubChem (CID 89243573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).