C21H19IN4O4S — CID 89246577
6-(2-iodo-5-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrosophenyl)-4-sulfanylidene-1H-pyridazin-3-one (PubChem CID 89246577) has the molecular formula C21H19IN4O4S and a molecular weight of 550.38 g/mol. Its IUPAC name is 6-(2-iodo-5-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrosophenyl)-4-sulfanylidene-1H-pyridazin-3-one.
| Compound Name | 6-(2-iodo-5-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrosophenyl)-4-sulfanylidene-1H-pyridazin-3-one |
|---|---|
| PubChem CID | 89246577 |
| Molecular Formula | C21H19IN4O4S |
| Molecular Weight | 550.38 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | 6-(2-iodo-5-methoxyphenyl)-2-(5-morpholin-4-yl-2-nitrosophenyl)-4-sulfanylidene-1H-pyridazin-3-one |
| SMILES | COc1ccc(I)c(-c2cc(=S)c(=O)n(-c3cc(N4CCOCC4)ccc3N=O)[nH]2)c1 |
| InChI | InChI=1S/C21H19IN4O4S/c1-29-14-3-4-16(22)15(11-14)18-12-20(31)21(27)26(23-18)19-10-13(2-5-17(19)24-28)25-6-8-30-9-7-25/h2-5,10-12,23H,6-9H2,1H3 |
| InChIKey | SJERUXQSEBGJSS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|