C23H23N5O2 — CID 89247746
(5R,6S)-2-amino-6-(3-aminophenyl)-3,6-dimethyl-5-[4-(2-oxo-1-pyridinyl)phenyl]-5H-pyrimidin-4-one (PubChem CID 89247746) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is (5R,6S)-2-amino-6-(3-aminophenyl)-3,6-dimethyl-5-[4-(2-oxo-1-pyridinyl)phenyl]-5H-pyrimidin-4-one.
| Compound Name | (5R,6S)-2-amino-6-(3-aminophenyl)-3,6-dimethyl-5-[4-(2-oxo-1-pyridinyl)phenyl]-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 89247746 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (5R,6S)-2-amino-6-(3-aminophenyl)-3,6-dimethyl-5-[4-(2-oxo-1-pyridinyl)phenyl]-5H-pyrimidin-4-one |
| SMILES | CN1C(=O)[C@H](c2ccc(-n3ccccc3=O)cc2)[C@@](C)(c2cccc(N)c2)N=C1N |
| InChI | InChI=1S/C23H23N5O2/c1-23(16-6-5-7-17(24)14-16)20(21(30)27(2)22(25)26-23)15-9-11-18(12-10-15)28-13-4-3-8-19(28)29/h3-14,20H,24H2,1-2H3,(H2,25,26)/t20-,23+/m0/s1 |
| InChIKey | WGUZYMKAIIUMKN-NZQKXSOJSA-N |
| XLogP | 2.21 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|