C20H19BN4O2S — CID 89247960
CID 89247960 (PubChem CID 89247960) has the molecular formula C20H19BN4O2S and a molecular weight of 390.28 g/mol.
| Compound Name | CID 89247960 |
|---|---|
| PubChem CID | 89247960 |
| Molecular Formula | C20H19BN4O2S |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(O)c([C@@]2(C)N=C(N)N(C)C(=O)C2c2ccc(C3(C#N)CC3)cc2)s1 |
| InChI | InChI=1S/C20H19BN4O2S/c1-19(16-13(26)9-14(21)28-16)15(17(27)25(2)18(23)24-19)11-3-5-12(6-4-11)20(10-22)7-8-20/h3-6,9,15,26H,7-8H2,1-2H3,(H2,23,24)/t15?,19-/m0/s1 |
| InChIKey | VEJFKGSCDNANQM-FUBQLUNQSA-N |
| XLogP | 1.59 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|