C26H30N4OS — CID 89248139
(6S)-2-amino-6-[4-(3-aminophenyl)thiophen-2-yl]-3,6-dimethyl-5-[3-(3-methylphenyl)propyl]-5H-pyrimidin-4-one (PubChem CID 89248139) has the molecular formula C26H30N4OS and a molecular weight of 446.62 g/mol. Its IUPAC name is (6S)-2-amino-6-[4-(3-aminophenyl)thiophen-2-yl]-3,6-dimethyl-5-[3-(3-methylphenyl)propyl]-5H-pyrimidin-4-one.
| Compound Name | (6S)-2-amino-6-[4-(3-aminophenyl)thiophen-2-yl]-3,6-dimethyl-5-[3-(3-methylphenyl)propyl]-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 89248139 |
| Molecular Formula | C26H30N4OS |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (6S)-2-amino-6-[4-(3-aminophenyl)thiophen-2-yl]-3,6-dimethyl-5-[3-(3-methylphenyl)propyl]-5H-pyrimidin-4-one |
| SMILES | Cc1cccc(CCCC2C(=O)N(C)C(N)=N[C@]2(C)c2cc(-c3cccc(N)c3)cs2)c1 |
| InChI | InChI=1S/C26H30N4OS/c1-17-7-4-8-18(13-17)9-5-12-22-24(31)30(3)25(28)29-26(22,2)23-15-20(16-32-23)19-10-6-11-21(27)14-19/h4,6-8,10-11,13-16,22H,5,9,12,27H2,1-3H3,(H2,28,29)/t22?,26-/m0/s1 |
| InChIKey | UUNQNVZBVVFCHZ-XGCAABAXSA-N |
| XLogP | 4.95 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|