C17H18BN3OS — CID 89247738
CID 89247738 (PubChem CID 89247738) has the molecular formula C17H18BN3OS and a molecular weight of 323.23 g/mol.
| Compound Name | CID 89247738 |
|---|---|
| PubChem CID | 89247738 |
| Molecular Formula | C17H18BN3OS |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | — |
| SMILES | [B]c1csc([C@@]2(C)N=C(N)N(C)C(=O)[C@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H18BN3OS/c1-17(14-9-12(18)10-23-14)13(8-11-6-4-3-5-7-11)15(22)21(2)16(19)20-17/h3-7,9-10,13H,8H2,1-2H3,(H2,19,20)/t13-,17+/m1/s1 |
| InChIKey | FTLUXSSJCYQDLH-DYVFJYSZSA-N |
| XLogP | 1.40 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|