About (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one
(6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one (PubChem CID 122641675) has the molecular formula C21H23N3OS
and a molecular weight of 365.50 g/mol. Its IUPAC name is (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one.
Molecular Properties
| Compound Name | (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one |
| PubChem CID | 122641675 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one |
| SMILES | CCCc1ccc2sc3ccc([C@]4(C)CC(=O)N(C)C(N)=N4)cc3c2c1 |
| InChI | InChI=1S/C21H23N3OS/c1-4-5-13-6-8-17-15(10-13)16-11-14(7-9-18(16)26-17)21(2)12-19(25)24(3)20(22)23-21/h6-11H,4-5,12H2,1-3H3,(H2,22,23)/t21-/m0/s1 |
| InChIKey | ODHJGITVUNMHKJ-NRFANRHFSA-N |
| XLogP | 4.40 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one?
The IUPAC name of (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one (CID 122641675) is (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one.
What is the SMILES notation for (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one?
The canonical SMILES for (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one is CCCc1ccc2sc3ccc([C@]4(C)CC(=O)N(C)C(N)=N4)cc3c2c1.
What is the InChIKey of (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one?
The InChIKey is ODHJGITVUNMHKJ-NRFANRHFSA-N. The full InChI is InChI=1S/C21H23N3OS/c1-4-5-13-6-8-17-15(10-13)16-11-14(7-9-18(16)26-17)21(2)12-19(25)24(3)20(22)23-21/h6-11H,4-5,12H2,1-3H3,(H2,22,23)/t21-/m0/s1.
What are the key properties of (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one?
(6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one has a molecular weight of 365.50 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2-amino-3,6-dimethyl-6-(8-propyldibenzothiophen-2-yl)-5H-pyrimidin-4-one is sourced from PubChem (CID 122641675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).