C21H19N3O3S — CID 122641609
(6S)-2-amino-6-(5,5-dioxo-8-prop-1-ynyldibenzothiophen-2-yl)-3,6-dimethyl-5H-pyrimidin-4-one (PubChem CID 122641609) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is (6S)-2-amino-6-(5,5-dioxo-8-prop-1-ynyldibenzothiophen-2-yl)-3,6-dimethyl-5H-pyrimidin-4-one.
| Compound Name | (6S)-2-amino-6-(5,5-dioxo-8-prop-1-ynyldibenzothiophen-2-yl)-3,6-dimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 122641609 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (6S)-2-amino-6-(5,5-dioxo-8-prop-1-ynyldibenzothiophen-2-yl)-3,6-dimethyl-5H-pyrimidin-4-one |
| SMILES | CC#Cc1ccc2c(c1)-c1cc([C@]3(C)CC(=O)N(C)C(N)=N3)ccc1S2(=O)=O |
| InChI | InChI=1S/C21H19N3O3S/c1-4-5-13-6-8-17-15(10-13)16-11-14(7-9-18(16)28(17,26)27)21(2)12-19(25)24(3)20(22)23-21/h6-11H,12H2,1-3H3,(H2,22,23)/t21-/m0/s1 |
| InChIKey | DBCMIQRJTSMXPV-NRFANRHFSA-N |
| XLogP | 2.26 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|