C22H21N3O2S — CID 122641670
(6S)-2-amino-6-[8-(3-methoxyprop-1-ynyl)dibenzothiophen-2-yl]-3,6-dimethyl-5H-pyrimidin-4-one (PubChem CID 122641670) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is (6S)-2-amino-6-[8-(3-methoxyprop-1-ynyl)dibenzothiophen-2-yl]-3,6-dimethyl-5H-pyrimidin-4-one.
| Compound Name | (6S)-2-amino-6-[8-(3-methoxyprop-1-ynyl)dibenzothiophen-2-yl]-3,6-dimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 122641670 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (6S)-2-amino-6-[8-(3-methoxyprop-1-ynyl)dibenzothiophen-2-yl]-3,6-dimethyl-5H-pyrimidin-4-one |
| SMILES | COCC#Cc1ccc2sc3ccc([C@]4(C)CC(=O)N(C)C(N)=N4)cc3c2c1 |
| InChI | InChI=1S/C22H21N3O2S/c1-22(13-20(26)25(2)21(23)24-22)15-7-9-19-17(12-15)16-11-14(5-4-10-27-3)6-8-18(16)28-19/h6-9,11-12H,10,13H2,1-3H3,(H2,23,24)/t22-/m0/s1 |
| InChIKey | SVJJCPJCDWYWOO-QFIPXVFZSA-N |
| XLogP | 3.44 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|