C22H19F2N3OS — CID 122641684
(6S)-2-amino-3-(2,2-difluoroethyl)-6-methyl-6-(8-prop-1-ynyldibenzothiophen-2-yl)-5H-pyrimidin-4-one (PubChem CID 122641684) has the molecular formula C22H19F2N3OS and a molecular weight of 411.48 g/mol. Its IUPAC name is (6S)-2-amino-3-(2,2-difluoroethyl)-6-methyl-6-(8-prop-1-ynyldibenzothiophen-2-yl)-5H-pyrimidin-4-one.
| Compound Name | (6S)-2-amino-3-(2,2-difluoroethyl)-6-methyl-6-(8-prop-1-ynyldibenzothiophen-2-yl)-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 122641684 |
| Molecular Formula | C22H19F2N3OS |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (6S)-2-amino-3-(2,2-difluoroethyl)-6-methyl-6-(8-prop-1-ynyldibenzothiophen-2-yl)-5H-pyrimidin-4-one |
| SMILES | CC#Cc1ccc2sc3ccc([C@]4(C)CC(=O)N(CC(F)F)C(N)=N4)cc3c2c1 |
| InChI | InChI=1S/C22H19F2N3OS/c1-3-4-13-5-7-17-15(9-13)16-10-14(6-8-18(16)29-17)22(2)11-20(28)27(12-19(23)24)21(25)26-22/h5-10,19H,11-12H2,1-2H3,(H2,25,26)/t22-/m0/s1 |
| InChIKey | WOTUUUZFIWUIGA-QFIPXVFZSA-N |
| XLogP | 4.45 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|