C17H14FIN4OS — CID 25002892
5-[5-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]-2-iodothiophen-3-yl]-2-fluorobenzonitrile (PubChem CID 25002892) has the molecular formula C17H14FIN4OS and a molecular weight of 468.30 g/mol. Its IUPAC name is 5-[5-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]-2-iodothiophen-3-yl]-2-fluorobenzonitrile.
| Compound Name | 5-[5-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]-2-iodothiophen-3-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 25002892 |
| Molecular Formula | C17H14FIN4OS |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 5-[5-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]-2-iodothiophen-3-yl]-2-fluorobenzonitrile |
| SMILES | C[C@]1(CC(=O)N(C(=N1)N)C)C2=CC(=C(S2)I)C3=CC(=C(C=C3)F)C#N |
| InChI | InChI=1S/C17H14FIN4OS/c1-17(7-14(24)23(2)16(21)22-17)13-6-11(15(19)25-13)9-3-4-12(18)10(5-9)8-20/h3-6H,7H2,1-2H3,(H2,21,22)/t17-/m0/s1 |
| InChIKey | FDVLZXWWAANVJS-KRWDZBQOSA-N |
| XLogP | 2.30 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | 637 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|