C11H23NO — CID 89249287
1-[(2,4-dimethylcyclobutyl)-methylamino]butan-1-ol (PubChem CID 89249287) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-[(2,4-dimethylcyclobutyl)-methylamino]butan-1-ol.
| Compound Name | 1-[(2,4-dimethylcyclobutyl)-methylamino]butan-1-ol |
|---|---|
| PubChem CID | 89249287 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 1-[(2,4-dimethylcyclobutyl)-methylamino]butan-1-ol |
| SMILES | CCCC(O)N(C)C1C(C)CC1C |
| InChI | InChI=1S/C11H23NO/c1-5-6-10(13)12(4)11-8(2)7-9(11)3/h8-11,13H,5-7H2,1-4H3 |
| InChIKey | GRYVXMNQJBNOGV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|