C11H13BBrN5O — CID 89250322
CID 89250322 (PubChem CID 89250322) has the molecular formula C11H13BBrN5O and a molecular weight of 321.98 g/mol.
| Compound Name | CID 89250322 |
|---|---|
| PubChem CID | 89250322 |
| Molecular Formula | C11H13BBrN5O |
| Molecular Weight | 321.98 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)NCCCc2cnc(N)[nH]2)[nH]c1Br |
| InChI | InChI=1S/C11H13BBrN5O/c12-7-4-8(18-9(7)13)10(19)15-3-1-2-6-5-16-11(14)17-6/h4-5,18H,1-3H2,(H,15,19)(H3,14,16,17) |
| InChIKey | ZJPBVWVZNWJSAN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.98 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|