C21H21ClN4O5 — CID 89251538
N-[(2R,3R)-1-(2-chlorophenyl)-3-hydroxy-4-(hydroxyamino)-4-oxobutan-2-yl]-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzamide (PubChem CID 89251538) has the molecular formula C21H21ClN4O5 and a molecular weight of 444.88 g/mol. Its IUPAC name is N-[(2R,3R)-1-(2-chlorophenyl)-3-hydroxy-4-(hydroxyamino)-4-oxobutan-2-yl]-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzamide.
| Compound Name | N-[(2R,3R)-1-(2-chlorophenyl)-3-hydroxy-4-(hydroxyamino)-4-oxobutan-2-yl]-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 89251538 |
| Molecular Formula | C21H21ClN4O5 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[(2R,3R)-1-(2-chlorophenyl)-3-hydroxy-4-(hydroxyamino)-4-oxobutan-2-yl]-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzamide |
| SMILES | CC1=NN(c2ccc(C(=O)N[C@H](Cc3ccccc3Cl)[C@@H](O)C(=O)NO)cc2)C(=O)C1 |
| InChI | InChI=1S/C21H21ClN4O5/c1-12-10-18(27)26(24-12)15-8-6-13(7-9-15)20(29)23-17(19(28)21(30)25-31)11-14-4-2-3-5-16(14)22/h2-9,17,19,28,31H,10-11H2,1H3,(H,23,29)(H,25,30)/t17-,19-/m1/s1 |
| InChIKey | GEXQLUZVFJLXJZ-IEBWSBKVSA-N |
| XLogP | 1.66 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|