C18H30O3 — CID 89253657
4-[3-(4-methoxycyclohexyl)propyl]cyclohexane-1,1-dicarbaldehyde (PubChem CID 89253657) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is 4-[3-(4-methoxycyclohexyl)propyl]cyclohexane-1,1-dicarbaldehyde.
| Compound Name | 4-[3-(4-methoxycyclohexyl)propyl]cyclohexane-1,1-dicarbaldehyde |
|---|---|
| PubChem CID | 89253657 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 4-[3-(4-methoxycyclohexyl)propyl]cyclohexane-1,1-dicarbaldehyde |
| SMILES | COC1CCC(CCCC2CCC(C=O)(C=O)CC2)CC1 |
| InChI | InChI=1S/C18H30O3/c1-21-17-7-5-15(6-8-17)3-2-4-16-9-11-18(13-19,14-20)12-10-16/h13-17H,2-12H2,1H3 |
| InChIKey | BQLGDMUZPHSONG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|