C9H8ClN5S — CID 89255962
5-(2-chloro-5-methylpyrimidin-4-yl)sulfanylpyrimidin-2-amine (PubChem CID 89255962) has the molecular formula C9H8ClN5S and a molecular weight of 253.72 g/mol. Its IUPAC name is 5-(2-chloro-5-methylpyrimidin-4-yl)sulfanylpyrimidin-2-amine.
| Compound Name | 5-(2-chloro-5-methylpyrimidin-4-yl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 89255962 |
| Molecular Formula | C9H8ClN5S |
| Molecular Weight | 253.72 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 5-(2-chloro-5-methylpyrimidin-4-yl)sulfanylpyrimidin-2-amine |
| SMILES | Cc1cnc(Cl)nc1Sc1cnc(N)nc1 |
| InChI | InChI=1S/C9H8ClN5S/c1-5-2-12-8(10)15-7(5)16-6-3-13-9(11)14-4-6/h2-4H,1H3,(H2,11,13,14) |
| InChIKey | CKKJSCNLYVAEMI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.72 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |