C8H10N4 — CID 89256639
5,6-dimethylcyclohex-5-ene-1,2,3,4-tetraimine (PubChem CID 89256639) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 5,6-dimethylcyclohex-5-ene-1,2,3,4-tetraimine.
| Compound Name | 5,6-dimethylcyclohex-5-ene-1,2,3,4-tetraimine |
|---|---|
| PubChem CID | 89256639 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5,6-dimethylcyclohex-5-ene-1,2,3,4-tetraimine |
| SMILES | [H]/N=c1c(C)c(C)c(=N\[H])/c(=N\[H])c\1=N/[H] |
| InChI | InChI=1S/C8H10N4/c1-3-4(2)6(10)8(12)7(11)5(3)9/h9-12H,1-2H3/b9-5+,10-6+,11-7+,12-8+ |
| InChIKey | GCOUYMNWNKINJA-HFBXSBKTSA-N |
| XLogP | -0.90 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|