C8H13N3O — CID 89257484
4-[(3R)-pyrrolidin-3-yl]-1,3-dihydropyrazin-2-one (PubChem CID 89257484) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-[(3R)-pyrrolidin-3-yl]-1,3-dihydropyrazin-2-one.
| Compound Name | 4-[(3R)-pyrrolidin-3-yl]-1,3-dihydropyrazin-2-one |
|---|---|
| PubChem CID | 89257484 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 4-[(3R)-pyrrolidin-3-yl]-1,3-dihydropyrazin-2-one |
| SMILES | O=C1CN([C@@H]2CCNC2)C=CN1 |
| InChI | InChI=1S/C8H13N3O/c12-8-6-11(4-3-10-8)7-1-2-9-5-7/h3-4,7,9H,1-2,5-6H2,(H,10,12)/t7-/m1/s1 |
| InChIKey | WTJAIVYSTCOOKS-SSDOTTSWSA-N |
| XLogP | -0.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |