C38H54B2N8O7 — CID 89258160
CID 89258160 (PubChem CID 89258160) has the molecular formula C38H54B2N8O7 and a molecular weight of 756.52 g/mol.
| Compound Name | CID 89258160 |
|---|---|
| PubChem CID | 89258160 |
| Molecular Formula | C38H54B2N8O7 |
| Molecular Weight | 756.52 g/mol |
| Exact Mass | 756.43 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](NC(=O)N2CCC(NC(=O)NC)CC2)C(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)N2CCC(c3ccncc3)CC2)cc([B])c1O |
| InChI | InChI=1S/C38H54B2N8O7/c1-38(2,3)55-37(54)43-14-6-5-7-30(34(51)47-17-10-26(11-18-47)25-8-15-42-16-9-25)45-33(50)31(23-24-21-28(39)32(49)29(40)22-24)46-36(53)48-19-12-27(13-20-48)44-35(52)41-4/h8-9,15-16,21-22,26-27,30-31,49H,5-7,10-14,17-20,23H2,1-4H3,(H,43,54)(H,45,50)(H,46,53)(H2,41,44,52)/t30?,31-/m1/s1 |
| InChIKey | IZCXKIMXBBLEEQ-NLIBRCFJSA-N |
| XLogP | 0.97 |
| TPSA | 194.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|