C25H34O6 — CID 89258732
5-[1-[(1R,4aR,6S,8aR)-6-(2-hydroxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl]ethyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde (PubChem CID 89258732) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 5-[1-[(1R,4aR,6S,8aR)-6-(2-hydroxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl]ethyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde.
| Compound Name | 5-[1-[(1R,4aR,6S,8aR)-6-(2-hydroxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl]ethyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 89258732 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 5-[1-[(1R,4aR,6S,8aR)-6-(2-hydroxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,6,7,8-octahydronaphthalen-1-yl]ethyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde |
| SMILES | C=C1CC[C@H](C(C)c2c(O)c(C=O)c(O)c(C=O)c2O)[C@@]2(C)CC[C@H](C(C)(C)O)C[C@H]12 |
| InChI | InChI=1S/C25H34O6/c1-13-6-7-18(25(5)9-8-15(10-19(13)25)24(3,4)31)14(2)20-22(29)16(11-26)21(28)17(12-27)23(20)30/h11-12,14-15,18-19,28-31H,1,6-10H2,2-5H3/t14?,15-,18+,19+,25+/m0/s1 |
| InChIKey | DPKWUSNIIDKOAS-GUKQYEEYSA-N |
| XLogP | 4.69 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|