C28H38O5 — CID 98042541
5-[(1R)-1-[(1aS,4aR,7R,7aS,7bS)-1a,7,7b-trimethyl-4-methylidene-2,3,4a,5,6,7a-hexahydro-1H-cyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde (PubChem CID 98042541) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 5-[(1R)-1-[(1aS,4aR,7R,7aS,7bS)-1a,7,7b-trimethyl-4-methylidene-2,3,4a,5,6,7a-hexahydro-1H-cyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde.
| Compound Name | 5-[(1R)-1-[(1aS,4aR,7R,7aS,7bS)-1a,7,7b-trimethyl-4-methylidene-2,3,4a,5,6,7a-hexahydro-1H-cyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 98042541 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 5-[(1R)-1-[(1aS,4aR,7R,7aS,7bS)-1a,7,7b-trimethyl-4-methylidene-2,3,4a,5,6,7a-hexahydro-1H-cyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde |
| SMILES | C=C1CC[C@@]2(C)C[C@@]2(C)[C@H]2[C@H]1CC[C@]2(C)[C@@H](CC(C)C)c1c(O)c(C=O)c(O)c(C=O)c1O |
| InChI | InChI=1S/C28H38O5/c1-15(2)11-20(21-23(32)18(12-29)22(31)19(13-30)24(21)33)27(5)10-8-17-16(3)7-9-26(4)14-28(26,6)25(17)27/h12-13,15,17,20,25,31-33H,3,7-11,14H2,1-2,4-6H3/t17-,20-,25-,26-,27+,28-/m0/s1 |
| InChIKey | XELFFJRYLFQFHL-KPIUDDHLSA-N |
| XLogP | 6.36 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|