C31H46O5 — CID 143696872
acetylene;5-[(1S)-1-[(1S,2R)-3-[(2S)-butan-2-yl]-1-methyl-2-[(1R,3R)-2,2,3-trimethylcyclopropyl]cyclopentyl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde (PubChem CID 143696872) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is acetylene;5-[(1S)-1-[(1S,2R)-3-[(2S)-butan-2-yl]-1-methyl-2-[(1R,3R)-2,2,3-trimethylcyclopropyl]cyclopentyl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde.
| Compound Name | acetylene;5-[(1S)-1-[(1S,2R)-3-[(2S)-butan-2-yl]-1-methyl-2-[(1R,3R)-2,2,3-trimethylcyclopropyl]cyclopentyl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 143696872 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | acetylene;5-[(1S)-1-[(1S,2R)-3-[(2S)-butan-2-yl]-1-methyl-2-[(1R,3R)-2,2,3-trimethylcyclopropyl]cyclopentyl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde |
| SMILES | C#C.CC[C@H](C)C1CC[C@](C)([C@H](CC(C)C)c2c(O)c(C=O)c(O)c(C=O)c2O)[C@H]1[C@H]1[C@@H](C)C1(C)C |
| InChI | InChI=1S/C29H44O5.C2H2/c1-9-16(4)18-10-11-29(8,24(18)23-17(5)28(23,6)7)21(12-15(2)3)22-26(33)19(13-30)25(32)20(14-31)27(22)34;1-2/h13-18,21,23-24,32-34H,9-12H2,1-8H3;1-2H/t16-,17+,18?,21+,23+,24+,29+;/m0./s1 |
| InChIKey | RUZUQSCWRLKOLB-DZHPTPTISA-N |
| XLogP | 7.18 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|