C24H28ClN3O3 — CID 89259233
2-[3-[[(3R)-3-butyl-4-(6-chloro-1,3-benzoxazol-2-yl)piperazin-1-yl]methyl]phenoxy]acetaldehyde (PubChem CID 89259233) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-[3-[[(3R)-3-butyl-4-(6-chloro-1,3-benzoxazol-2-yl)piperazin-1-yl]methyl]phenoxy]acetaldehyde.
| Compound Name | 2-[3-[[(3R)-3-butyl-4-(6-chloro-1,3-benzoxazol-2-yl)piperazin-1-yl]methyl]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 89259233 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[3-[[(3R)-3-butyl-4-(6-chloro-1,3-benzoxazol-2-yl)piperazin-1-yl]methyl]phenoxy]acetaldehyde |
| SMILES | CCCC[C@@H]1CN(Cc2cccc(OCC=O)c2)CCN1c1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C24H28ClN3O3/c1-2-3-6-20-17-27(16-18-5-4-7-21(14-18)30-13-12-29)10-11-28(20)24-26-22-9-8-19(25)15-23(22)31-24/h4-5,7-9,12,14-15,20H,2-3,6,10-11,13,16-17H2,1H3/t20-/m1/s1 |
| InChIKey | HYWFZMKUZRNNPK-HXUWFJFHSA-N |
| XLogP | 4.94 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|