C12H13N3O3 — CID 89262028
2-(4-amino-3-cyanophenyl)morpholine-4-carboxylic acid (PubChem CID 89262028) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(4-amino-3-cyanophenyl)morpholine-4-carboxylic acid.
| Compound Name | 2-(4-amino-3-cyanophenyl)morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 89262028 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-(4-amino-3-cyanophenyl)morpholine-4-carboxylic acid |
| SMILES | N#Cc1cc(C2CN(C(=O)O)CCO2)ccc1N |
| InChI | InChI=1S/C12H13N3O3/c13-6-9-5-8(1-2-10(9)14)11-7-15(12(16)17)3-4-18-11/h1-2,5,11H,3-4,7,14H2,(H,16,17) |
| InChIKey | NDPIOSOBNQNCBL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|