C31H34N6O2 — CID 89263668
2-(3-amino-5-tert-butyl-2-hydroxyanilino)-1-[4-[(2-pyrrolidin-1-ylpyrimidin-4-yl)amino]naphthalen-1-yl]prop-2-en-1-one (PubChem CID 89263668) has the molecular formula C31H34N6O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-(3-amino-5-tert-butyl-2-hydroxyanilino)-1-[4-[(2-pyrrolidin-1-ylpyrimidin-4-yl)amino]naphthalen-1-yl]prop-2-en-1-one.
| Compound Name | 2-(3-amino-5-tert-butyl-2-hydroxyanilino)-1-[4-[(2-pyrrolidin-1-ylpyrimidin-4-yl)amino]naphthalen-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 89263668 |
| Molecular Formula | C31H34N6O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 2-(3-amino-5-tert-butyl-2-hydroxyanilino)-1-[4-[(2-pyrrolidin-1-ylpyrimidin-4-yl)amino]naphthalen-1-yl]prop-2-en-1-one |
| SMILES | C=C(Nc1cc(C(C)(C)C)cc(N)c1O)C(=O)c1ccc(Nc2ccnc(N3CCCC3)n2)c2ccccc12 |
| InChI | InChI=1S/C31H34N6O2/c1-19(34-26-18-20(31(2,3)4)17-24(32)29(26)39)28(38)23-11-12-25(22-10-6-5-9-21(22)23)35-27-13-14-33-30(36-27)37-15-7-8-16-37/h5-6,9-14,17-18,34,39H,1,7-8,15-16,32H2,2-4H3,(H,33,35,36) |
| InChIKey | KWHMDLKELLKPMN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|