C31H34N6O4 — CID 91549963
N-(3-amino-5-tert-butyl-2-methoxyphenyl)-2-[4-[morpholin-4-yl(pyrimidin-4-yl)amino]naphthalen-1-yl]-2-oxoacetamide (PubChem CID 91549963) has the molecular formula C31H34N6O4 and a molecular weight of 554.65 g/mol. Its IUPAC name is N-(3-amino-5-tert-butyl-2-methoxyphenyl)-2-[4-[morpholin-4-yl(pyrimidin-4-yl)amino]naphthalen-1-yl]-2-oxoacetamide.
| Compound Name | N-(3-amino-5-tert-butyl-2-methoxyphenyl)-2-[4-[morpholin-4-yl(pyrimidin-4-yl)amino]naphthalen-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 91549963 |
| Molecular Formula | C31H34N6O4 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | N-(3-amino-5-tert-butyl-2-methoxyphenyl)-2-[4-[morpholin-4-yl(pyrimidin-4-yl)amino]naphthalen-1-yl]-2-oxoacetamide |
| SMILES | COc1c(N)cc(C(C)(C)C)cc1NC(=O)C(=O)c1ccc(N(c2ccncn2)N2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C31H34N6O4/c1-31(2,3)20-17-24(32)29(40-4)25(18-20)35-30(39)28(38)23-9-10-26(22-8-6-5-7-21(22)23)37(27-11-12-33-19-34-27)36-13-15-41-16-14-36/h5-12,17-19H,13-16,32H2,1-4H3,(H,35,39) |
| InChIKey | DLYRZAWREGLUAF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|