C16H16N2 — CID 89263991
7,9-dimethyl-2-prop-2-enylpyrrolo[2,3-h]quinoline (PubChem CID 89263991) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 7,9-dimethyl-2-prop-2-enylpyrrolo[2,3-h]quinoline.
| Compound Name | 7,9-dimethyl-2-prop-2-enylpyrrolo[2,3-h]quinoline |
|---|---|
| PubChem CID | 89263991 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 7,9-dimethyl-2-prop-2-enylpyrrolo[2,3-h]quinoline |
| SMILES | C=CCc1ccc2ccc3c(c(C)cn3C)c2n1 |
| InChI | InChI=1S/C16H16N2/c1-4-5-13-8-6-12-7-9-14-15(16(12)17-13)11(2)10-18(14)3/h4,6-10H,1,5H2,2-3H3 |
| InChIKey | UJPSKGSQIMSLDP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|