C51H42BO2 — CID 89265155
CID 89265155 (PubChem CID 89265155) has the molecular formula C51H42BO2 and a molecular weight of 697.71 g/mol.
| Compound Name | CID 89265155 |
|---|---|
| PubChem CID | 89265155 |
| Molecular Formula | C51H42BO2 |
| Molecular Weight | 697.71 g/mol |
| Exact Mass | 697.33 |
| IUPAC Name | — |
| SMILES | C=C/C(=C\c1ccccc1C)c1ccc2c(c1)C(c1ccccc1)(c1ccc([B]OC(C)(C)C(=C)O)cc1)c1cc(-c3ccc4ccccc4c3)ccc1-2 |
| InChI | InChI=1S/C51H42BO2/c1-6-36(30-38-16-11-10-14-34(38)2)41-22-28-46-47-29-23-42(40-21-20-37-15-12-13-17-39(37)31-40)33-49(47)51(48(46)32-41,43-18-8-7-9-19-43)44-24-26-45(27-25-44)52-54-50(4,5)35(3)53/h6-33,53H,1,3H2,2,4-5H3/b36-30+ |
| InChIKey | DAHKFUQGVATYNN-FMIFUCRQSA-N |
| XLogP | 12.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.71 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|