C23H25N5O — CID 89265487
4-N-benzyl-2-N-[(Z)-4-imino-2-methoxy-4-phenylbut-2-enyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 89265487) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-N-benzyl-2-N-[(Z)-4-imino-2-methoxy-4-phenylbut-2-enyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N-[(Z)-4-imino-2-methoxy-4-phenylbut-2-enyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89265487 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-N-benzyl-2-N-[(Z)-4-imino-2-methoxy-4-phenylbut-2-enyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | [H]/N=C(/C=C(/CNc1nc(C)cc(NCc2ccccc2)n1)OC)c1ccccc1 |
| InChI | InChI=1S/C23H25N5O/c1-17-13-22(25-15-18-9-5-3-6-10-18)28-23(27-17)26-16-20(29-2)14-21(24)19-11-7-4-8-12-19/h3-14,24H,15-16H2,1-2H3,(H2,25,26,27,28)/b20-14-,24-21- |
| InChIKey | NUNUMZLPSSUKNB-GTKWNZKQSA-N |
| XLogP | 4.41 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|