C27H26N4O — CID 89234413
2-N-[(2Z)-2-methoxy-4-phenylpenta-2,4-dienyl]-6-methyl-4-N-naphthalen-2-ylpyrimidine-2,4-diamine (PubChem CID 89234413) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-N-[(2Z)-2-methoxy-4-phenylpenta-2,4-dienyl]-6-methyl-4-N-naphthalen-2-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[(2Z)-2-methoxy-4-phenylpenta-2,4-dienyl]-6-methyl-4-N-naphthalen-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89234413 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-N-[(2Z)-2-methoxy-4-phenylpenta-2,4-dienyl]-6-methyl-4-N-naphthalen-2-ylpyrimidine-2,4-diamine |
| SMILES | C=C(/C=C(/CNc1nc(C)cc(Nc2ccc3ccccc3c2)n1)OC)c1ccccc1 |
| InChI | InChI=1S/C27H26N4O/c1-19(21-9-5-4-6-10-21)15-25(32-3)18-28-27-29-20(2)16-26(31-27)30-24-14-13-22-11-7-8-12-23(22)17-24/h4-17H,1,18H2,2-3H3,(H2,28,29,30,31)/b25-15- |
| InChIKey | HARZLPHLKOGOQV-MYYYXRDXSA-N |
| XLogP | 6.34 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|