C20H20N5O2- — CID 143702152
(2Z)-1-[[4-methyl-6-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidin-2-yl]amino]-4-phenylpenta-2,4-dien-2-olate (PubChem CID 143702152) has the molecular formula C20H20N5O2- and a molecular weight of 362.41 g/mol. Its IUPAC name is (2Z)-1-[[4-methyl-6-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidin-2-yl]amino]-4-phenylpenta-2,4-dien-2-olate.
| Compound Name | (2Z)-1-[[4-methyl-6-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidin-2-yl]amino]-4-phenylpenta-2,4-dien-2-olate |
|---|---|
| PubChem CID | 143702152 |
| Molecular Formula | C20H20N5O2- |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (2Z)-1-[[4-methyl-6-[(5-methyl-1,2-oxazol-3-yl)amino]pyrimidin-2-yl]amino]-4-phenylpenta-2,4-dien-2-olate |
| SMILES | C=C(/C=C(\[O-])CNc1nc(C)cc(Nc2cc(C)on2)n1)c1ccccc1 |
| InChI | InChI=1S/C20H21N5O2/c1-13(16-7-5-4-6-8-16)9-17(26)12-21-20-22-14(2)10-18(24-20)23-19-11-15(3)27-25-19/h4-11,26H,1,12H2,2-3H3,(H2,21,22,23,24,25)/p-1/b17-9- |
| InChIKey | AMJRQTHBVAJPBG-MFOYZWKCSA-M |
| XLogP | 3.19 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|