C25H20ClF3N2O3 — CID 89267882
methyl 3-[4-[[1-(6-chlorocyclohexa-1,3-dien-1-yl)-3-(trifluoromethyl)pyrazol-5-yl]methoxy]phenyl]benzoate (PubChem CID 89267882) has the molecular formula C25H20ClF3N2O3 and a molecular weight of 488.89 g/mol. Its IUPAC name is methyl 3-[4-[[1-(6-chlorocyclohexa-1,3-dien-1-yl)-3-(trifluoromethyl)pyrazol-5-yl]methoxy]phenyl]benzoate.
| Compound Name | methyl 3-[4-[[1-(6-chlorocyclohexa-1,3-dien-1-yl)-3-(trifluoromethyl)pyrazol-5-yl]methoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 89267882 |
| Molecular Formula | C25H20ClF3N2O3 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | methyl 3-[4-[[1-(6-chlorocyclohexa-1,3-dien-1-yl)-3-(trifluoromethyl)pyrazol-5-yl]methoxy]phenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(OCc3cc(C(F)(F)F)nn3C3=CC=CCC3Cl)cc2)c1 |
| InChI | InChI=1S/C25H20ClF3N2O3/c1-33-24(32)18-6-4-5-17(13-18)16-9-11-20(12-10-16)34-15-19-14-23(25(27,28)29)30-31(19)22-8-3-2-7-21(22)26/h2-6,8-14,21H,7,15H2,1H3 |
| InChIKey | HMPDSULBDXVPIB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|