C18H14Cl2F3N3O3 — CID 89267938
2-[1-(6-chlorocyclohexa-1,3-dien-1-yl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-(3-chloro-4-hydroxyphenyl)acetamide (PubChem CID 89267938) has the molecular formula C18H14Cl2F3N3O3 and a molecular weight of 448.23 g/mol. Its IUPAC name is 2-[1-(6-chlorocyclohexa-1,3-dien-1-yl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-(3-chloro-4-hydroxyphenyl)acetamide.
| Compound Name | 2-[1-(6-chlorocyclohexa-1,3-dien-1-yl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-(3-chloro-4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 89267938 |
| Molecular Formula | C18H14Cl2F3N3O3 |
| Molecular Weight | 448.23 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 2-[1-(6-chlorocyclohexa-1,3-dien-1-yl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-(3-chloro-4-hydroxyphenyl)acetamide |
| SMILES | O=C(COc1cc(C(F)(F)F)nn1C1=CC=CCC1Cl)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2F3N3O3/c19-11-3-1-2-4-13(11)26-17(8-15(25-26)18(21,22)23)29-9-16(28)24-10-5-6-14(27)12(20)7-10/h1-2,4-8,11,27H,3,9H2,(H,24,28) |
| InChIKey | IFCHDUCSLAPIJS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|