C18H32N8O — CID 89270725
2-N-[(Z)-aminodiazenyl]-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-N-[2-(dimethylamino)ethyl]-1-N-(3-imidazol-1-ylpropyl)prop-2-ene-1,2-diamine (PubChem CID 89270725) has the molecular formula C18H32N8O and a molecular weight of 376.51 g/mol. Its IUPAC name is 2-N-[(Z)-aminodiazenyl]-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-N-[2-(dimethylamino)ethyl]-1-N-(3-imidazol-1-ylpropyl)prop-2-ene-1,2-diamine.
| Compound Name | 2-N-[(Z)-aminodiazenyl]-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-N-[2-(dimethylamino)ethyl]-1-N-(3-imidazol-1-ylpropyl)prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 89270725 |
| Molecular Formula | C18H32N8O |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 2-N-[(Z)-aminodiazenyl]-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]-2-N-[2-(dimethylamino)ethyl]-1-N-(3-imidazol-1-ylpropyl)prop-2-ene-1,2-diamine |
| SMILES | C=C(C(NCCCn1ccnc1)[C@@H]1CCC=CO1)N(CCN(C)C)/N=N\N |
| InChI | InChI=1S/C18H32N8O/c1-16(26(23-22-19)13-12-24(2)3)18(17-7-4-5-14-27-17)21-8-6-10-25-11-9-20-15-25/h5,9,11,14-15,17-18,21H,1,4,6-8,10,12-13H2,2-3H3,(H2,19,23)/t17-,18?/m0/s1 |
| InChIKey | XIRITUAXEZNEGO-ZENAZSQFSA-N |
| XLogP | 1.54 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|