C17H27N7O3 — CID 89270717
methyl 2-[[(Z)-aminodiazenyl]-[3-[(2S)-3,4-dihydro-2H-pyran-2-yl]-3-(3-imidazol-1-ylpropylamino)prop-1-en-2-yl]amino]acetate (PubChem CID 89270717) has the molecular formula C17H27N7O3 and a molecular weight of 377.45 g/mol. Its IUPAC name is methyl 2-[[(Z)-aminodiazenyl]-[3-[(2S)-3,4-dihydro-2H-pyran-2-yl]-3-(3-imidazol-1-ylpropylamino)prop-1-en-2-yl]amino]acetate.
| Compound Name | methyl 2-[[(Z)-aminodiazenyl]-[3-[(2S)-3,4-dihydro-2H-pyran-2-yl]-3-(3-imidazol-1-ylpropylamino)prop-1-en-2-yl]amino]acetate |
|---|---|
| PubChem CID | 89270717 |
| Molecular Formula | C17H27N7O3 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | methyl 2-[[(Z)-aminodiazenyl]-[3-[(2S)-3,4-dihydro-2H-pyran-2-yl]-3-(3-imidazol-1-ylpropylamino)prop-1-en-2-yl]amino]acetate |
| SMILES | C=C(C(NCCCn1ccnc1)[C@@H]1CCC=CO1)N(CC(=O)OC)/N=N\N |
| InChI | InChI=1S/C17H27N7O3/c1-14(24(22-21-18)12-16(25)26-2)17(15-6-3-4-11-27-15)20-7-5-9-23-10-8-19-13-23/h4,8,10-11,13,15,17,20H,1,3,5-7,9,12H2,2H3,(H2,18,22)/t15-,17?/m0/s1 |
| InChIKey | MASJTERKMNFZKM-MYJWUSKBSA-N |
| XLogP | 1.15 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|