C23H30ClN3O2 — CID 89271593
N-(4-tert-butylphenyl)-4-(4-chlorocyclohexa-1,5-diene-1-carbonyl)-1,4-diazepane-1-carboxamide (PubChem CID 89271593) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-(4-chlorocyclohexa-1,5-diene-1-carbonyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-4-(4-chlorocyclohexa-1,5-diene-1-carbonyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 89271593 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-(4-chlorocyclohexa-1,5-diene-1-carbonyl)-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)N2CCCN(C(=O)C3=CCC(Cl)C=C3)CC2)cc1 |
| InChI | InChI=1S/C23H30ClN3O2/c1-23(2,3)18-7-11-20(12-8-18)25-22(29)27-14-4-13-26(15-16-27)21(28)17-5-9-19(24)10-6-17/h5-9,11-12,19H,4,10,13-16H2,1-3H3,(H,25,29) |
| InChIKey | PTIFTRULRLOBHZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|