C30H28ClFN2OS — CID 89271857
N-[4-[3-[[1-(3-chloro-1-benzothiophen-2-yl)ethenyl-cyclohexylamino]methyl]-4-fluorophenyl]phenyl]formamide (PubChem CID 89271857) has the molecular formula C30H28ClFN2OS and a molecular weight of 519.09 g/mol. Its IUPAC name is N-[4-[3-[[1-(3-chloro-1-benzothiophen-2-yl)ethenyl-cyclohexylamino]methyl]-4-fluorophenyl]phenyl]formamide.
| Compound Name | N-[4-[3-[[1-(3-chloro-1-benzothiophen-2-yl)ethenyl-cyclohexylamino]methyl]-4-fluorophenyl]phenyl]formamide |
|---|---|
| PubChem CID | 89271857 |
| Molecular Formula | C30H28ClFN2OS |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | N-[4-[3-[[1-(3-chloro-1-benzothiophen-2-yl)ethenyl-cyclohexylamino]methyl]-4-fluorophenyl]phenyl]formamide |
| SMILES | C=C(c1sc2ccccc2c1Cl)N(Cc1cc(-c2ccc(NC=O)cc2)ccc1F)C1CCCCC1 |
| InChI | InChI=1S/C30H28ClFN2OS/c1-20(30-29(31)26-9-5-6-10-28(26)36-30)34(25-7-3-2-4-8-25)18-23-17-22(13-16-27(23)32)21-11-14-24(15-12-21)33-19-35/h5-6,9-17,19,25H,1-4,7-8,18H2,(H,33,35) |
| InChIKey | JGZZHYLWPCBLJO-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|