C22H29BN4O — CID 89272283
CID 89272283 (PubChem CID 89272283) has the molecular formula C22H29BN4O and a molecular weight of 376.31 g/mol.
| Compound Name | CID 89272283 |
|---|---|
| PubChem CID | 89272283 |
| Molecular Formula | C22H29BN4O |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(NC(=O)C(C)(C)CC)cc1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29BN4O/c1-4-22(2,3)21(28)25-20-14-17(19(23)15-24-20)16-26-10-12-27(13-11-26)18-8-6-5-7-9-18/h5-9,14-15H,4,10-13,16H2,1-3H3,(H,24,25,28) |
| InChIKey | GWRHHRKUEFNRCW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|