C5H9N3O — CID 89275564
3-(methylamino)-2,3-dihydro-1H-pyrazin-6-one (PubChem CID 89275564) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is 3-(methylamino)-2,3-dihydro-1H-pyrazin-6-one.
| Compound Name | 3-(methylamino)-2,3-dihydro-1H-pyrazin-6-one |
|---|---|
| PubChem CID | 89275564 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 3-(methylamino)-2,3-dihydro-1H-pyrazin-6-one |
| SMILES | CNC1CNC(=O)C=N1 |
| InChI | InChI=1S/C5H9N3O/c1-6-4-2-8-5(9)3-7-4/h3-4,6H,2H2,1H3,(H,8,9) |
| InChIKey | VZMQZWUMEKHHIJ-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |