C21H26Cl2N4O3S2 — CID 89277474
1-(diethylamino)ethyl 3-[5-(5,6-dichloro-1,3-dimethylbenzimidazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 89277474) has the molecular formula C21H26Cl2N4O3S2 and a molecular weight of 517.50 g/mol. Its IUPAC name is 1-(diethylamino)ethyl 3-[5-(5,6-dichloro-1,3-dimethylbenzimidazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | 1-(diethylamino)ethyl 3-[5-(5,6-dichloro-1,3-dimethylbenzimidazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 89277474 |
| Molecular Formula | C21H26Cl2N4O3S2 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 1-(diethylamino)ethyl 3-[5-(5,6-dichloro-1,3-dimethylbenzimidazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCN(CC)C(C)OC(=O)CCN1C(=O)C(=C2N(C)c3cc(Cl)c(Cl)cc3N2C)SC1=S |
| InChI | InChI=1S/C21H26Cl2N4O3S2/c1-6-26(7-2)12(3)30-17(28)8-9-27-20(29)18(32-21(27)31)19-24(4)15-10-13(22)14(23)11-16(15)25(19)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | AJMUXBVANJCRCA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|