C27H31N3O4S2 — CID 89280758
1-(diethylamino)ethyl 3-[(5E)-5-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 89280758) has the molecular formula C27H31N3O4S2 and a molecular weight of 525.70 g/mol. Its IUPAC name is 1-(diethylamino)ethyl 3-[(5E)-5-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | 1-(diethylamino)ethyl 3-[(5E)-5-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 89280758 |
| Molecular Formula | C27H31N3O4S2 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 1-(diethylamino)ethyl 3-[(5E)-5-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCN1/C(=C2\SC(=S)N(CCC(=O)OC(C)N(CC)CC)C2=O)Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C27H31N3O4S2/c1-5-28(6-2)18(4)33-23(31)15-16-30-25(32)24(36-27(30)35)26-29(7-3)21-17-20(13-14-22(21)34-26)19-11-9-8-10-12-19/h8-14,17-18H,5-7,15-16H2,1-4H3/b26-24+ |
| InChIKey | KMLSYFNCIPSOAN-SHHOIMCASA-N |
| XLogP | 5.22 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|