C36H36N4O4S2 — CID 3603904
propan-2-yl 6-[5-[2-[5-(1,3-benzoxazol-2-yl)-3-ethyl-1-phenylbenzimidazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 3603904) has the molecular formula C36H36N4O4S2 and a molecular weight of 652.84 g/mol. Its IUPAC name is propan-2-yl 6-[5-[2-[5-(1,3-benzoxazol-2-yl)-3-ethyl-1-phenylbenzimidazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | propan-2-yl 6-[5-[2-[5-(1,3-benzoxazol-2-yl)-3-ethyl-1-phenylbenzimidazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 3603904 |
| Molecular Formula | C36H36N4O4S2 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | propan-2-yl 6-[5-[2-[5-(1,3-benzoxazol-2-yl)-3-ethyl-1-phenylbenzimidazol-2-ylidene]ethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CCN1C(=CC=C2SC(=S)N(CCCCCC(=O)OC(C)C)C2=O)N(c2ccccc2)c2ccc(-c3nc4ccccc4o3)cc21 |
| InChI | InChI=1S/C36H36N4O4S2/c1-4-38-29-23-25(34-37-27-15-10-11-16-30(27)44-34)18-19-28(29)40(26-13-7-5-8-14-26)32(38)21-20-31-35(42)39(36(45)46-31)22-12-6-9-17-33(41)43-24(2)3/h5,7-8,10-11,13-16,18-21,23-24H,4,6,9,12,17,22H2,1-3H3 |
| InChIKey | OMBUGIISIOCZBY-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|