C19H15KN2O5S2Se — CID 59937868
potassium [(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-selenazolidin-5-ylidene)-5-phenyl-1,3-benzoxazol-3-yl]methanesulfonate (PubChem CID 59937868) has the molecular formula C19H15KN2O5S2Se and a molecular weight of 533.53 g/mol. Its IUPAC name is potassium [(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-selenazolidin-5-ylidene)-5-phenyl-1,3-benzoxazol-3-yl]methanesulfonate.
| Compound Name | potassium [(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-selenazolidin-5-ylidene)-5-phenyl-1,3-benzoxazol-3-yl]methanesulfonate |
|---|---|
| PubChem CID | 59937868 |
| Molecular Formula | C19H15KN2O5S2Se |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.92 |
| IUPAC Name | potassium [(2Z)-2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-selenazolidin-5-ylidene)-5-phenyl-1,3-benzoxazol-3-yl]methanesulfonate |
| SMILES | CCN1C(=O)/C(=C2/Oc3ccc(-c4ccccc4)cc3N2CS(=O)(=O)[O-])[Se]C1=S.[K+] |
| InChI | InChI=1S/C19H16N2O5S2Se.K/c1-2-20-17(22)16(29-19(20)27)18-21(11-28(23,24)25)14-10-13(8-9-15(14)26-18)12-6-4-3-5-7-12;/h3-10H,2,11H2,1H3,(H,23,24,25);/q;+1/p-1/b18-16-; |
| InChIKey | SWYPLTBYODGXIB-FTUZMNKQSA-M |
| XLogP | -0.92 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|