C22H20N2O2S2 — CID 90919781
3-ethyl-5-[2-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)ethenyl]-4-hydroxy-1,3-thiazole-2-thione (PubChem CID 90919781) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 3-ethyl-5-[2-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)ethenyl]-4-hydroxy-1,3-thiazole-2-thione.
| Compound Name | 3-ethyl-5-[2-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)ethenyl]-4-hydroxy-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 90919781 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-ethyl-5-[2-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)ethenyl]-4-hydroxy-1,3-thiazole-2-thione |
| SMILES | CCN1C(=C=Cc2sc(=S)n(CC)c2O)Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C22H20N2O2S2/c1-3-23-17-14-16(15-8-6-5-7-9-15)10-11-18(17)26-20(23)13-12-19-21(25)24(4-2)22(27)28-19/h5-12,14,25H,3-4H2,1-2H3 |
| InChIKey | GKXHMEPOXNJNGW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|