C16H14N4O — CID 89279280
4-[(1Z,3E)-5-amino-1-hydroxy-1-pyrazin-2-ylpenta-1,3-dien-2-yl]benzonitrile (PubChem CID 89279280) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[(1Z,3E)-5-amino-1-hydroxy-1-pyrazin-2-ylpenta-1,3-dien-2-yl]benzonitrile.
| Compound Name | 4-[(1Z,3E)-5-amino-1-hydroxy-1-pyrazin-2-ylpenta-1,3-dien-2-yl]benzonitrile |
|---|---|
| PubChem CID | 89279280 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-[(1Z,3E)-5-amino-1-hydroxy-1-pyrazin-2-ylpenta-1,3-dien-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(C(/C=C/CN)=C(\O)c2cnccn2)cc1 |
| InChI | InChI=1S/C16H14N4O/c17-7-1-2-14(13-5-3-12(10-18)4-6-13)16(21)15-11-19-8-9-20-15/h1-6,8-9,11,21H,7,17H2/b2-1+,16-14- |
| InChIKey | WQOYCHUYCTUKRI-CZAKHBHRSA-N |
| XLogP | 2.29 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|