C49H47BN2O4S3 — CID 89281915
CID 89281915 (PubChem CID 89281915) has the molecular formula C49H47BN2O4S3 and a molecular weight of 834.94 g/mol.
| Compound Name | CID 89281915 |
|---|---|
| PubChem CID | 89281915 |
| Molecular Formula | C49H47BN2O4S3 |
| Molecular Weight | 834.94 g/mol |
| Exact Mass | 834.28 |
| IUPAC Name | — |
| SMILES | [B]CS(=O)(=O)c1c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)sc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c1S(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C49H47BN2O4S3/c1-2-3-4-5-6-19-36-58(53,54)48-46(38-28-32-44(33-29-38)51(40-20-11-7-12-21-40)41-22-13-8-14-23-41)57-47(49(48)59(55,56)37-50)39-30-34-45(35-31-39)52(42-24-15-9-16-25-42)43-26-17-10-18-27-43/h7-18,20-35H,2-6,19,36-37H2,1H3 |
| InChIKey | PCVCUZVOWOITPH-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.94 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|